About 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide
4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide (PubChem CID 15052873) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide.
Molecular Properties
| Compound Name | 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide |
| PubChem CID | 15052873 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1cc(C(=O)NCc2ccccc2)ncn1 |
| InChI | InChI=1S/C20H18N4O2/c25-19(21-12-15-7-3-1-4-8-15)17-11-18(24-14-23-17)20(26)22-13-16-9-5-2-6-10-16/h1-11,14H,12-13H2,(H,21,25)(H,22,26) |
| InChIKey | WIUCYEOLRGUYEH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide?
The IUPAC name of 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide (CID 15052873) is 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide.
What is the SMILES notation for 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide?
The canonical SMILES for 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide is O=C(NCc1ccccc1)c1cc(C(=O)NCc2ccccc2)ncn1.
What is the InChIKey of 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide?
The InChIKey is WIUCYEOLRGUYEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c25-19(21-12-15-7-3-1-4-8-15)17-11-18(24-14-23-17)20(26)22-13-16-9-5-2-6-10-16/h1-11,14H,12-13H2,(H,21,25)(H,22,26).
What are the key properties of 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide?
4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide has a molecular weight of 346.39 g/mol, XLogP of 2.34, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,6-N-dibenzylpyrimidine-4,6-dicarboxamide is sourced from PubChem (CID 15052873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).