C17H14FN3O2 — CID 150528862
6-fluoro-2-[4-(hydroxymethyl)phenyl]-3,10,12-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one (PubChem CID 150528862) has the molecular formula C17H14FN3O2 and a molecular weight of 311.32 g/mol. Its IUPAC name is 6-fluoro-2-[4-(hydroxymethyl)phenyl]-3,10,12-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one.
| Compound Name | 6-fluoro-2-[4-(hydroxymethyl)phenyl]-3,10,12-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 150528862 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 6-fluoro-2-[4-(hydroxymethyl)phenyl]-3,10,12-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCNc2c(-c3ccc(CO)cc3)[nH]c3cc(F)cc1c23 |
| InChI | InChI=1S/C17H14FN3O2/c18-11-5-12-14-13(6-11)21-15(16(14)19-8-20-17(12)23)10-3-1-9(7-22)2-4-10/h1-6,19,21-22H,7-8H2,(H,20,23) |
| InChIKey | IDKLHOZNHBIDHS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |