C16H11Cl2N3O2 — CID 15052914
2-[3-chloro-4-[(4-chlorophenyl)methyl]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 15052914) has the molecular formula C16H11Cl2N3O2 and a molecular weight of 348.19 g/mol. Its IUPAC name is 2-[3-chloro-4-[(4-chlorophenyl)methyl]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3-chloro-4-[(4-chlorophenyl)methyl]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 15052914 |
| Molecular Formula | C16H11Cl2N3O2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-[3-chloro-4-[(4-chlorophenyl)methyl]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2ccc(Cc3ccc(Cl)cc3)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H11Cl2N3O2/c17-12-4-1-10(2-5-12)7-11-3-6-13(8-14(11)18)21-16(23)20-15(22)9-19-21/h1-6,8-9H,7H2,(H,20,22,23) |
| InChIKey | YHHAXGIUYARGGZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |