C13H4Br2F8N2O — CID 150532651
3-[2,6-dibromo-4-(trifluoromethyl)phenyl]-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one (PubChem CID 150532651) has the molecular formula C13H4Br2F8N2O and a molecular weight of 515.98 g/mol. Its IUPAC name is 3-[2,6-dibromo-4-(trifluoromethyl)phenyl]-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one.
| Compound Name | 3-[2,6-dibromo-4-(trifluoromethyl)phenyl]-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 150532651 |
| Molecular Formula | C13H4Br2F8N2O |
| Molecular Weight | 515.98 g/mol |
| Exact Mass | 513.86 |
| IUPAC Name | 3-[2,6-dibromo-4-(trifluoromethyl)phenyl]-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)F)ncn1-c1c(Br)cc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C13H4Br2F8N2O/c14-6-1-5(12(18,19)20)2-7(15)10(6)25-4-24-8(3-9(25)26)11(16,17)13(21,22)23/h1-4H |
| InChIKey | IEEFBBUNRHJDET-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.98 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|