C10H11F3N2O4 — CID 150533227
2-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid (PubChem CID 150533227) has the molecular formula C10H11F3N2O4 and a molecular weight of 280.20 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 150533227 |
| Molecular Formula | C10H11F3N2O4 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid |
| SMILES | O=C(O)c1cc2n(n1)CC(CCOCC(F)(F)F)O2 |
| InChI | InChI=1S/C10H11F3N2O4/c11-10(12,13)5-18-2-1-6-4-15-8(19-6)3-7(14-15)9(16)17/h3,6H,1-2,4-5H2,(H,16,17) |
| InChIKey | IEHDMAUOJDBUTF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|