C15H12ClN5O2 — CID 150535612
2-chloro-N-[2-(4-nitrophenyl)ethyl]pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 150535612) has the molecular formula C15H12ClN5O2 and a molecular weight of 329.75 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-nitrophenyl)ethyl]pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[2-(4-nitrophenyl)ethyl]pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 150535612 |
| Molecular Formula | C15H12ClN5O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-chloro-N-[2-(4-nitrophenyl)ethyl]pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(CCNc2nc(Cl)nc3ncccc23)cc1 |
| InChI | InChI=1S/C15H12ClN5O2/c16-15-19-13-12(2-1-8-17-13)14(20-15)18-9-7-10-3-5-11(6-4-10)21(22)23/h1-6,8H,7,9H2,(H,17,18,19,20) |
| InChIKey | IETVLKGZKKZPJO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|