CH5O9PS2 — CID 150540601
[hydroxy(sulfooxy)phosphoryl] methanesulfonate (PubChem CID 150540601) has the molecular formula CH5O9PS2 and a molecular weight of 256.15 g/mol. Its IUPAC name is [hydroxy(sulfooxy)phosphoryl] methanesulfonate.
| Compound Name | [hydroxy(sulfooxy)phosphoryl] methanesulfonate |
|---|---|
| PubChem CID | 150540601 |
| Molecular Formula | CH5O9PS2 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 255.91 |
| IUPAC Name | [hydroxy(sulfooxy)phosphoryl] methanesulfonate |
| SMILES | CS(=O)(=O)OP(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/CH5O9PS2/c1-12(4,5)9-11(2,3)10-13(6,7)8/h1H3,(H,2,3)(H,6,7,8) |
| InChIKey | IFUDVXHWFGCLIH-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|