About (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one
(4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one (PubChem CID 15054181) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one |
| PubChem CID | 15054181 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one |
| SMILES | NC1=N[C@H](Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C10H11N3O/c11-10-12-8(9(14)13-10)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H3,11,12,13,14)/t8-/m1/s1 |
| InChIKey | BIRXIIDWAVKMQN-MRVPVSSYSA-N |
| XLogP | 0.04 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one?
The IUPAC name of (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one (CID 15054181) is (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one.
What is the SMILES notation for (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one?
The canonical SMILES for (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one is NC1=N[C@H](Cc2ccccc2)C(=O)N1.
What is the InChIKey of (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one?
The InChIKey is BIRXIIDWAVKMQN-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H11N3O/c11-10-12-8(9(14)13-10)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H3,11,12,13,14)/t8-/m1/s1.
What are the key properties of (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one?
(4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one has a molecular weight of 189.22 g/mol, XLogP of 0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-amino-4-benzyl-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 15054181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).