C28H56O6PS+ — CID 150541986
[1-(3-decylsulfanyldodecan-2-yloxy)-1-hydroxy-2-methoxy-2-oxoethyl]-oxo-propoxyphosphanium (PubChem CID 150541986) has the molecular formula C28H56O6PS+ and a molecular weight of 551.79 g/mol. Its IUPAC name is [1-(3-decylsulfanyldodecan-2-yloxy)-1-hydroxy-2-methoxy-2-oxoethyl]-oxo-propoxyphosphanium.
| Compound Name | [1-(3-decylsulfanyldodecan-2-yloxy)-1-hydroxy-2-methoxy-2-oxoethyl]-oxo-propoxyphosphanium |
|---|---|
| PubChem CID | 150541986 |
| Molecular Formula | C28H56O6PS+ |
| Molecular Weight | 551.79 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | [1-(3-decylsulfanyldodecan-2-yloxy)-1-hydroxy-2-methoxy-2-oxoethyl]-oxo-propoxyphosphanium |
| SMILES | CCCCCCCCCCSC(CCCCCCCCC)C(C)OC(O)(C(=O)OC)[P+](=O)OCCC |
| InChI | InChI=1S/C28H56O6PS/c1-6-9-11-13-15-17-19-21-24-36-26(22-20-18-16-14-12-10-7-2)25(4)34-28(30,27(29)32-5)35(31)33-23-8-3/h25-26,30H,6-24H2,1-5H3/q+1 |
| InChIKey | JDCINZRCDJYWAN-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.79 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|