C23H20F2N4O4 — CID 150545991
(5S)-9,9-bis(4-fluorophenyl)-5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxonona-6,8-dienoic acid (PubChem CID 150545991) has the molecular formula C23H20F2N4O4 and a molecular weight of 454.43 g/mol. Its IUPAC name is (5S)-9,9-bis(4-fluorophenyl)-5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxonona-6,8-dienoic acid.
| Compound Name | (5S)-9,9-bis(4-fluorophenyl)-5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxonona-6,8-dienoic acid |
|---|---|
| PubChem CID | 150545991 |
| Molecular Formula | C23H20F2N4O4 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (5S)-9,9-bis(4-fluorophenyl)-5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxonona-6,8-dienoic acid |
| SMILES | Cn1nnnc1C(C=C[C@@H](O)CC(=O)CC(=O)O)=C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H20F2N4O4/c1-29-23(26-27-28-29)20(11-10-18(30)12-19(31)13-21(32)33)22(14-2-6-16(24)7-3-14)15-4-8-17(25)9-5-15/h2-11,18,30H,12-13H2,1H3,(H,32,33)/t18-/m1/s1 |
| InChIKey | IGWODAKESNNCMM-GOSISDBHSA-N |
| XLogP | 2.80 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|