C24H36O5Si — CID 15054808
ethyl 15-[tert-butyl(dimethyl)silyl]oxy-8-oxo-7-oxatetracyclo[7.7.0.02,6.010,14]hexadeca-2(6),14-diene-9-carboxylate (PubChem CID 15054808) has the molecular formula C24H36O5Si and a molecular weight of 432.63 g/mol. Its IUPAC name is ethyl 15-[tert-butyl(dimethyl)silyl]oxy-8-oxo-7-oxatetracyclo[7.7.0.02,6.010,14]hexadeca-2(6),14-diene-9-carboxylate.
| Compound Name | ethyl 15-[tert-butyl(dimethyl)silyl]oxy-8-oxo-7-oxatetracyclo[7.7.0.02,6.010,14]hexadeca-2(6),14-diene-9-carboxylate |
|---|---|
| PubChem CID | 15054808 |
| Molecular Formula | C24H36O5Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | ethyl 15-[tert-butyl(dimethyl)silyl]oxy-8-oxo-7-oxatetracyclo[7.7.0.02,6.010,14]hexadeca-2(6),14-diene-9-carboxylate |
| SMILES | CCOC(=O)C12C(=O)OC3=C(CCC3)C1CC(O[Si](C)(C)C(C)(C)C)=C1CCCC12 |
| InChI | InChI=1S/C24H36O5Si/c1-7-27-21(25)24-17-12-8-10-15(17)20(29-30(5,6)23(2,3)4)14-18(24)16-11-9-13-19(16)28-22(24)26/h17-18H,7-14H2,1-6H3 |
| InChIKey | AMPZHGVVFJGSIV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|