About 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene
1-tert-butylperoxy-3,5,5-trimethylhex-1-ene (PubChem CID 150549023) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene.
Molecular Properties
| Compound Name | 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene |
| PubChem CID | 150549023 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene |
| SMILES | CC(C=COOC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-11(10-12(2,3)4)8-9-14-15-13(5,6)7/h8-9,11H,10H2,1-7H3 |
| InChIKey | IHMDSUHFGWHNTQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene?
The IUPAC name of 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene (CID 150549023) is 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene.
What is the SMILES notation for 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene?
The canonical SMILES for 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene is CC(C=COOC(C)(C)C)CC(C)(C)C.
What is the InChIKey of 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene?
The InChIKey is IHMDSUHFGWHNTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-11(10-12(2,3)4)8-9-14-15-13(5,6)7/h8-9,11H,10H2,1-7H3.
What are the key properties of 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene?
1-tert-butylperoxy-3,5,5-trimethylhex-1-ene has a molecular weight of 214.35 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylperoxy-3,5,5-trimethylhex-1-ene is sourced from PubChem (CID 150549023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).