C11H15F11O2Si — CID 15055054
dimethyl-[3-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl]silane (PubChem CID 15055054) has the molecular formula C11H15F11O2Si and a molecular weight of 416.30 g/mol. Its IUPAC name is dimethyl-[3-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl]silane.
| Compound Name | dimethyl-[3-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl]silane |
|---|---|
| PubChem CID | 15055054 |
| Molecular Formula | C11H15F11O2Si |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | dimethyl-[3-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl]silane |
| SMILES | C[SiH](C)CCCOCC(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F11O2Si/c1-25(2)5-3-4-23-6-7(12,9(15,16)17)24-11(21,22)8(13,14)10(18,19)20/h25H,3-6H2,1-2H3 |
| InChIKey | XIIXVJSAQTYXGF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|