About (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea
(1,3-dichlorocyclohexa-2,4-dien-1-yl)urea (PubChem CID 150551382) has the molecular formula C7H8Cl2N2O
and a molecular weight of 207.06 g/mol. Its IUPAC name is (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea.
Molecular Properties
| Compound Name | (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea |
| PubChem CID | 150551382 |
| Molecular Formula | C7H8Cl2N2O |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea |
| SMILES | NC(=O)NC1(Cl)C=C(Cl)C=CC1 |
| InChI | InChI=1S/C7H8Cl2N2O/c8-5-2-1-3-7(9,4-5)11-6(10)12/h1-2,4H,3H2,(H3,10,11,12) |
| InChIKey | IHYKDPJJVNRHGM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea?
The IUPAC name of (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea (CID 150551382) is (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea.
What is the SMILES notation for (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea?
The canonical SMILES for (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea is NC(=O)NC1(Cl)C=C(Cl)C=CC1.
What is the InChIKey of (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea?
The InChIKey is IHYKDPJJVNRHGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl2N2O/c8-5-2-1-3-7(9,4-5)11-6(10)12/h1-2,4H,3H2,(H3,10,11,12).
What are the key properties of (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea?
(1,3-dichlorocyclohexa-2,4-dien-1-yl)urea has a molecular weight of 207.06 g/mol, XLogP of 1.67, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dichlorocyclohexa-2,4-dien-1-yl)urea is sourced from PubChem (CID 150551382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).