C30H32BrNO7 — CID 150551624
2-O-[2-(8-bromo-9-oxo-5,8,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)-2-oxoethyl] 1-O-tert-butyl (2S,5S)-5-methylpyrrolidine-1,2-dicarboxylate (PubChem CID 150551624) has the molecular formula C30H32BrNO7 and a molecular weight of 598.49 g/mol. Its IUPAC name is 2-O-[2-(8-bromo-9-oxo-5,8,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)-2-oxoethyl] 1-O-tert-butyl (2S,5S)-5-methylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-[2-(8-bromo-9-oxo-5,8,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)-2-oxoethyl] 1-O-tert-butyl (2S,5S)-5-methylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 150551624 |
| Molecular Formula | C30H32BrNO7 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | 2-O-[2-(8-bromo-9-oxo-5,8,10,11-tetrahydronaphtho[2,3-c]isochromen-3-yl)-2-oxoethyl] 1-O-tert-butyl (2S,5S)-5-methylpyrrolidine-1,2-dicarboxylate |
| SMILES | C[C@H]1CC[C@@H](C(=O)OCC(=O)c2ccc3c(c2)COc2cc4c(cc2-3)CCC(=O)C4Br)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H32BrNO7/c1-16-5-9-23(32(16)29(36)39-30(2,3)4)28(35)38-15-25(34)18-6-8-20-19(11-18)14-37-26-13-21-17(12-22(20)26)7-10-24(33)27(21)31/h6,8,11-13,16,23,27H,5,7,9-10,14-15H2,1-4H3/t16-,23-,27?/m0/s1 |
| InChIKey | IHZPGYJJVHJBRZ-QCCRFBSBSA-N |
| XLogP | 5.71 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|