C22H22F4N6O6S — CID 150552515
[(1R,2R,3S,4R)-4-[[5-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl] N-methylsulfamate (PubChem CID 150552515) has the molecular formula C22H22F4N6O6S and a molecular weight of 574.51 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[5-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl] N-methylsulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[5-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl] N-methylsulfamate |
|---|---|
| PubChem CID | 150552515 |
| Molecular Formula | C22H22F4N6O6S |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[5-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl] N-methylsulfamate |
| SMILES | CNS(=O)(=O)O[C@@H]1C[C@@H](Nc2ncncc2C(=O)c2ccn(Cc3ccc(C(F)(F)F)c(F)c3)n2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H22F4N6O6S/c1-27-39(36,37)38-17-7-16(19(34)20(17)35)30-21-12(8-28-10-29-21)18(33)15-4-5-32(31-15)9-11-2-3-13(14(23)6-11)22(24,25)26/h2-6,8,10,16-17,19-20,27,34-35H,7,9H2,1H3,(H,28,29,30)/t16-,17-,19+,20+/m1/s1 |
| InChIKey | IIEDKIDZMXAGEC-JYBIWHBTSA-N |
| XLogP | 0.87 |
| TPSA | 168.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |