About (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol
(2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol (PubChem CID 150552671) has the molecular formula C13H12N2OS2
and a molecular weight of 276.39 g/mol. Its IUPAC name is (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol.
Molecular Properties
| Compound Name | (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol |
| PubChem CID | 150552671 |
| Molecular Formula | C13H12N2OS2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol |
| SMILES | OC(c1cccs1)c1c(C2CC2)sc2cncn12 |
| InChI | InChI=1S/C13H12N2OS2/c16-12(9-2-1-5-17-9)11-13(8-3-4-8)18-10-6-14-7-15(10)11/h1-2,5-8,12,16H,3-4H2 |
| InChIKey | IIEYVDZQDUUISZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol?
The IUPAC name of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol (CID 150552671) is (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol.
What is the SMILES notation for (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol?
The canonical SMILES for (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol is OC(c1cccs1)c1c(C2CC2)sc2cncn12.
What is the InChIKey of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol?
The InChIKey is IIEYVDZQDUUISZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2OS2/c16-12(9-2-1-5-17-9)11-13(8-3-4-8)18-10-6-14-7-15(10)11/h1-2,5-8,12,16H,3-4H2.
What are the key properties of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol?
(2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol has a molecular weight of 276.39 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-thiophen-2-ylmethanol is sourced from PubChem (CID 150552671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).