About 1-amino-6-methylheptane-2,5-diol
1-amino-6-methylheptane-2,5-diol (PubChem CID 150557059) has the molecular formula C8H19NO2
and a molecular weight of 161.24 g/mol. Its IUPAC name is 1-amino-6-methylheptane-2,5-diol.
Molecular Properties
| Compound Name | 1-amino-6-methylheptane-2,5-diol |
| PubChem CID | 150557059 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 1-amino-6-methylheptane-2,5-diol |
| SMILES | CC(C)C(O)CCC(O)CN |
| InChI | InChI=1S/C8H19NO2/c1-6(2)8(11)4-3-7(10)5-9/h6-8,10-11H,3-5,9H2,1-2H3 |
| InChIKey | IJBGMUHFNDZEJB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-6-methylheptane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-6-methylheptane-2,5-diol?
The IUPAC name of 1-amino-6-methylheptane-2,5-diol (CID 150557059) is 1-amino-6-methylheptane-2,5-diol.
What is the SMILES notation for 1-amino-6-methylheptane-2,5-diol?
The canonical SMILES for 1-amino-6-methylheptane-2,5-diol is CC(C)C(O)CCC(O)CN.
What is the InChIKey of 1-amino-6-methylheptane-2,5-diol?
The InChIKey is IJBGMUHFNDZEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2/c1-6(2)8(11)4-3-7(10)5-9/h6-8,10-11H,3-5,9H2,1-2H3.
What are the key properties of 1-amino-6-methylheptane-2,5-diol?
1-amino-6-methylheptane-2,5-diol has a molecular weight of 161.24 g/mol, XLogP of 0.10, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-6-methylheptane-2,5-diol is sourced from PubChem (CID 150557059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).