About 2-phenyl-1,3-dihydroinden-2-amine
2-phenyl-1,3-dihydroinden-2-amine (PubChem CID 15055777) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-phenyl-1,3-dihydroinden-2-amine.
Molecular Properties
| Compound Name | 2-phenyl-1,3-dihydroinden-2-amine |
| PubChem CID | 15055777 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-phenyl-1,3-dihydroinden-2-amine |
| SMILES | NC1(c2ccccc2)Cc2ccccc2C1 |
| InChI | InChI=1S/C15H15N/c16-15(14-8-2-1-3-9-14)10-12-6-4-5-7-13(12)11-15/h1-9H,10-11,16H2 |
| InChIKey | GXTVEMKCNRJADK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-1,3-dihydroinden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-dihydroinden-2-amine?
The IUPAC name of 2-phenyl-1,3-dihydroinden-2-amine (CID 15055777) is 2-phenyl-1,3-dihydroinden-2-amine.
What is the SMILES notation for 2-phenyl-1,3-dihydroinden-2-amine?
The canonical SMILES for 2-phenyl-1,3-dihydroinden-2-amine is NC1(c2ccccc2)Cc2ccccc2C1.
What is the InChIKey of 2-phenyl-1,3-dihydroinden-2-amine?
The InChIKey is GXTVEMKCNRJADK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c16-15(14-8-2-1-3-9-14)10-12-6-4-5-7-13(12)11-15/h1-9H,10-11,16H2.
What are the key properties of 2-phenyl-1,3-dihydroinden-2-amine?
2-phenyl-1,3-dihydroinden-2-amine has a molecular weight of 209.29 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-dihydroinden-2-amine is sourced from PubChem (CID 15055777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).