About 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one
1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one (PubChem CID 150558288) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one.
Molecular Properties
| Compound Name | 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one |
| PubChem CID | 150558288 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one |
| SMILES | CCCCCC(=O)C1(OC)C=CC=C1 |
| InChI | InChI=1S/C12H18O2/c1-3-4-5-8-11(13)12(14-2)9-6-7-10-12/h6-7,9-10H,3-5,8H2,1-2H3 |
| InChIKey | IJHKUTRZQXHFAG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one?
The IUPAC name of 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one (CID 150558288) is 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one.
What is the SMILES notation for 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one?
The canonical SMILES for 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one is CCCCCC(=O)C1(OC)C=CC=C1.
What is the InChIKey of 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one?
The InChIKey is IJHKUTRZQXHFAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-3-4-5-8-11(13)12(14-2)9-6-7-10-12/h6-7,9-10H,3-5,8H2,1-2H3.
What are the key properties of 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one?
1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one has a molecular weight of 194.27 g/mol, XLogP of 2.65, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxycyclopenta-2,4-dien-1-yl)hexan-1-one is sourced from PubChem (CID 150558288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).