C13H19NO4 — CID 150559813
5-[2-(ethylamino)ethyl]-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 150559813) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-[2-(ethylamino)ethyl]-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 5-[2-(ethylamino)ethyl]-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150559813 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 5-[2-(ethylamino)ethyl]-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CCNCCC1=CC(C)(C(=O)O)CC(C(=O)O)=C1 |
| InChI | InChI=1S/C13H19NO4/c1-3-14-5-4-9-6-10(11(15)16)8-13(2,7-9)12(17)18/h6-7,14H,3-5,8H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | IJPMGMSIVFPBGK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|