C14H18O — CID 150562442
5-cyclohexyl-2,3-dihydro-1-benzofuran (PubChem CID 150562442) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-cyclohexyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-cyclohexyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 150562442 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 5-cyclohexyl-2,3-dihydro-1-benzofuran |
| SMILES | c1cc2c(cc1C1CCCCC1)CCO2 |
| InChI | InChI=1S/C14H18O/c1-2-4-11(5-3-1)12-6-7-14-13(10-12)8-9-15-14/h6-7,10-11H,1-5,8-9H2 |
| InChIKey | IKCWQTYYGVPURM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |