About 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate
1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate (PubChem CID 150564270) has the molecular formula C9H17NO5S
and a molecular weight of 251.30 g/mol. Its IUPAC name is 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate.
Molecular Properties
| Compound Name | 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate |
| PubChem CID | 150564270 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate |
| SMILES | CCC=CC(=O)OOS(=O)(=O)C(C)NCC |
| InChI | InChI=1S/C9H17NO5S/c1-4-6-7-9(11)14-15-16(12,13)8(3)10-5-2/h6-8,10H,4-5H2,1-3H3 |
| InChIKey | IKMVPXWGXAXZNX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate?
The IUPAC name of 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate (CID 150564270) is 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate.
What is the SMILES notation for 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate?
The canonical SMILES for 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate is CCC=CC(=O)OOS(=O)(=O)C(C)NCC.
What is the InChIKey of 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate?
The InChIKey is IKMVPXWGXAXZNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO5S/c1-4-6-7-9(11)14-15-16(12,13)8(3)10-5-2/h6-8,10H,4-5H2,1-3H3.
What are the key properties of 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate?
1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate has a molecular weight of 251.30 g/mol, XLogP of 0.71, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylamino)ethylsulfonyl pent-2-eneperoxoate is sourced from PubChem (CID 150564270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).