C17H24N2O2 — CID 150565764
N-acetyl-2-(3,5-dimethylpiperidin-1-yl)-N-phenylacetamide (PubChem CID 150565764) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-acetyl-2-(3,5-dimethylpiperidin-1-yl)-N-phenylacetamide.
| Compound Name | N-acetyl-2-(3,5-dimethylpiperidin-1-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 150565764 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-acetyl-2-(3,5-dimethylpiperidin-1-yl)-N-phenylacetamide |
| SMILES | CC(=O)N(C(=O)CN1CC(C)CC(C)C1)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O2/c1-13-9-14(2)11-18(10-13)12-17(21)19(15(3)20)16-7-5-4-6-8-16/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | IKUMSDVGMHYHEI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |