About ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate
ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate (PubChem CID 15056668) has the molecular formula C14H20ClNO3
and a molecular weight of 285.77 g/mol. Its IUPAC name is ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate |
| PubChem CID | 15056668 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)CONCc1ccccc1Cl |
| InChI | InChI=1S/C14H20ClNO3/c1-4-18-13(17)14(2,3)10-19-16-9-11-7-5-6-8-12(11)15/h5-8,16H,4,9-10H2,1-3H3 |
| InChIKey | KJJWYFVBYXTAOO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate?
The IUPAC name of ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate (CID 15056668) is ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate.
What is the SMILES notation for ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate?
The canonical SMILES for ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate is CCOC(=O)C(C)(C)CONCc1ccccc1Cl.
What is the InChIKey of ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate?
The InChIKey is KJJWYFVBYXTAOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO3/c1-4-18-13(17)14(2,3)10-19-16-9-11-7-5-6-8-12(11)15/h5-8,16H,4,9-10H2,1-3H3.
What are the key properties of ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate?
ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate has a molecular weight of 285.77 g/mol, XLogP of 2.95, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(2-chlorophenyl)methylamino]oxy-2,2-dimethylpropanoate is sourced from PubChem (CID 15056668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).