C9H15N3O3 — CID 15056723
1-tert-butyl-3-ethyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 15056723) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 1-tert-butyl-3-ethyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-tert-butyl-3-ethyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15056723 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 1-tert-butyl-3-ethyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCn1c(=O)[nH]c(=O)n(C(C)(C)C)c1=O |
| InChI | InChI=1S/C9H15N3O3/c1-5-11-6(13)10-7(14)12(8(11)15)9(2,3)4/h5H2,1-4H3,(H,10,13,14) |
| InChIKey | QGJIYCAGESWYFX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |