About 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline
4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline (PubChem CID 150567909) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline.
Molecular Properties
| Compound Name | 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline |
| PubChem CID | 150567909 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline |
| SMILES | Nc1ccc(C2=CCC(N)(N3CCOCC3)C=C2)cc1 |
| InChI | InChI=1S/C16H21N3O/c17-15-3-1-13(2-4-15)14-5-7-16(18,8-6-14)19-9-11-20-12-10-19/h1-7H,8-12,17-18H2 |
| InChIKey | ILFFFMBYMJUNIM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline?
The IUPAC name of 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline (CID 150567909) is 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline.
What is the SMILES notation for 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline?
The canonical SMILES for 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline is Nc1ccc(C2=CCC(N)(N3CCOCC3)C=C2)cc1.
What is the InChIKey of 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline?
The InChIKey is ILFFFMBYMJUNIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O/c17-15-3-1-13(2-4-15)14-5-7-16(18,8-6-14)19-9-11-20-12-10-19/h1-7H,8-12,17-18H2.
What are the key properties of 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline?
4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline has a molecular weight of 271.36 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-4-morpholin-4-ylcyclohexa-1,5-dien-1-yl)aniline is sourced from PubChem (CID 150567909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).