About 1-cyclopentylsulfonyl-2,3,4-triethylbenzene
1-cyclopentylsulfonyl-2,3,4-triethylbenzene (PubChem CID 150568568) has the molecular formula C17H26O2S
and a molecular weight of 294.46 g/mol. Its IUPAC name is 1-cyclopentylsulfonyl-2,3,4-triethylbenzene.
Molecular Properties
| Compound Name | 1-cyclopentylsulfonyl-2,3,4-triethylbenzene |
| PubChem CID | 150568568 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-cyclopentylsulfonyl-2,3,4-triethylbenzene |
| SMILES | CCc1ccc(S(=O)(=O)C2CCCC2)c(CC)c1CC |
| InChI | InChI=1S/C17H26O2S/c1-4-13-11-12-17(16(6-3)15(13)5-2)20(18,19)14-9-7-8-10-14/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | ILIRXCNSGQGAKN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentylsulfonyl-2,3,4-triethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylsulfonyl-2,3,4-triethylbenzene?
The IUPAC name of 1-cyclopentylsulfonyl-2,3,4-triethylbenzene (CID 150568568) is 1-cyclopentylsulfonyl-2,3,4-triethylbenzene.
What is the SMILES notation for 1-cyclopentylsulfonyl-2,3,4-triethylbenzene?
The canonical SMILES for 1-cyclopentylsulfonyl-2,3,4-triethylbenzene is CCc1ccc(S(=O)(=O)C2CCCC2)c(CC)c1CC.
What is the InChIKey of 1-cyclopentylsulfonyl-2,3,4-triethylbenzene?
The InChIKey is ILIRXCNSGQGAKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2S/c1-4-13-11-12-17(16(6-3)15(13)5-2)20(18,19)14-9-7-8-10-14/h11-12,14H,4-10H2,1-3H3.
What are the key properties of 1-cyclopentylsulfonyl-2,3,4-triethylbenzene?
1-cyclopentylsulfonyl-2,3,4-triethylbenzene has a molecular weight of 294.46 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylsulfonyl-2,3,4-triethylbenzene is sourced from PubChem (CID 150568568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).