C20H26FNO — CID 15056966
2-(4-fluoro-3-methylphenyl)-6,6-dimethyl-4-pyrrolidin-1-ylcyclohexene-1-carbaldehyde (PubChem CID 15056966) has the molecular formula C20H26FNO and a molecular weight of 315.43 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylphenyl)-6,6-dimethyl-4-pyrrolidin-1-ylcyclohexene-1-carbaldehyde.
| Compound Name | 2-(4-fluoro-3-methylphenyl)-6,6-dimethyl-4-pyrrolidin-1-ylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 15056966 |
| Molecular Formula | C20H26FNO |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 2-(4-fluoro-3-methylphenyl)-6,6-dimethyl-4-pyrrolidin-1-ylcyclohexene-1-carbaldehyde |
| SMILES | Cc1cc(C2=C(C=O)C(C)(C)CC(N3CCCC3)C2)ccc1F |
| InChI | InChI=1S/C20H26FNO/c1-14-10-15(6-7-19(14)21)17-11-16(22-8-4-5-9-22)12-20(2,3)18(17)13-23/h6-7,10,13,16H,4-5,8-9,11-12H2,1-3H3 |
| InChIKey | JQPYHMDGPQFXCN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|