C23H31F3N2OS — CID 150570168
(4S,5R)-3-(2,2-difluoroethyl)-4-(fluoromethyl)-2,2-dimethyl-5-[4-[2-(4-methylpentan-2-yl)-1,3-thiazol-5-yl]phenyl]-1,3-oxazolidine (PubChem CID 150570168) has the molecular formula C23H31F3N2OS and a molecular weight of 440.58 g/mol. Its IUPAC name is (4S,5R)-3-(2,2-difluoroethyl)-4-(fluoromethyl)-2,2-dimethyl-5-[4-[2-(4-methylpentan-2-yl)-1,3-thiazol-5-yl]phenyl]-1,3-oxazolidine.
| Compound Name | (4S,5R)-3-(2,2-difluoroethyl)-4-(fluoromethyl)-2,2-dimethyl-5-[4-[2-(4-methylpentan-2-yl)-1,3-thiazol-5-yl]phenyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 150570168 |
| Molecular Formula | C23H31F3N2OS |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (4S,5R)-3-(2,2-difluoroethyl)-4-(fluoromethyl)-2,2-dimethyl-5-[4-[2-(4-methylpentan-2-yl)-1,3-thiazol-5-yl]phenyl]-1,3-oxazolidine |
| SMILES | CC(C)CC(C)c1ncc(-c2ccc([C@H]3OC(C)(C)N(CC(F)F)[C@@H]3CF)cc2)s1 |
| InChI | InChI=1S/C23H31F3N2OS/c1-14(2)10-15(3)22-27-12-19(30-22)16-6-8-17(9-7-16)21-18(11-24)28(13-20(25)26)23(4,5)29-21/h6-9,12,14-15,18,20-21H,10-11,13H2,1-5H3/t15?,18-,21-/m1/s1 |
| InChIKey | ILRHLVVLLYGQNK-DOSTUVGRSA-N |
| XLogP | 6.67 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |