C8H8BrF3N2 — CID 150570781
6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 150570781) has the molecular formula C8H8BrF3N2 and a molecular weight of 269.06 g/mol. Its IUPAC name is 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 150570781 |
| Molecular Formula | C8H8BrF3N2 |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CN(C)c1cc(C(F)(F)F)cc(Br)n1 |
| InChI | InChI=1S/C8H8BrF3N2/c1-14(2)7-4-5(8(10,11)12)3-6(9)13-7/h3-4H,1-2H3 |
| InChIKey | ILUIWILQVFNASR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|