About 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine
6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 150570781) has the molecular formula C8H8BrF3N2
and a molecular weight of 269.06 g/mol. Its IUPAC name is 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 150570781 |
| Molecular Formula | C8H8BrF3N2 |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CN(C)c1cc(C(F)(F)F)cc(Br)n1 |
| InChI | InChI=1S/C8H8BrF3N2/c1-14(2)7-4-5(8(10,11)12)3-6(9)13-7/h3-4H,1-2H3 |
| InChIKey | ILUIWILQVFNASR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine (CID 150570781) is 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine is CN(C)c1cc(C(F)(F)F)cc(Br)n1.
What is the InChIKey of 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine?
The InChIKey is ILUIWILQVFNASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF3N2/c1-14(2)7-4-5(8(10,11)12)3-6(9)13-7/h3-4H,1-2H3.
What are the key properties of 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine?
6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine has a molecular weight of 269.06 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N,N-dimethyl-4-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 150570781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).