C11H24N2 — CID 15057317
N,N-dimethyl-4-piperidin-2-ylbutan-1-amine (PubChem CID 15057317) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is N,N-dimethyl-4-piperidin-2-ylbutan-1-amine.
| Compound Name | N,N-dimethyl-4-piperidin-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 15057317 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N,N-dimethyl-4-piperidin-2-ylbutan-1-amine |
| SMILES | CN(C)CCCCC1CCCCN1 |
| InChI | InChI=1S/C11H24N2/c1-13(2)10-6-4-8-11-7-3-5-9-12-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | HZOPTUXFZFTNGB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|