About ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate
ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate (PubChem CID 150573718) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate |
| PubChem CID | 150573718 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CC2(Cc3cc4ccccc4cc3CC2=O)C1 |
| InChI | InChI=1S/C19H19NO3/c1-2-23-18(22)20-11-19(12-20)10-16-8-14-6-4-3-5-13(14)7-15(16)9-17(19)21/h3-8H,2,9-12H2,1H3 |
| InChIKey | IMJIVSLGRVAFGW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate?
The IUPAC name of ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate (CID 150573718) is ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate.
What is the SMILES notation for ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate?
The canonical SMILES for ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate is CCOC(=O)N1CC2(Cc3cc4ccccc4cc3CC2=O)C1.
What is the InChIKey of ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate?
The InChIKey is IMJIVSLGRVAFGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO3/c1-2-23-18(22)20-11-19(12-20)10-16-8-14-6-4-3-5-13(14)7-15(16)9-17(19)21/h3-8H,2,9-12H2,1H3.
What are the key properties of ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate?
ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate has a molecular weight of 309.37 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxospiro[1,4-dihydroanthracene-2,3'-azetidine]-1'-carboxylate is sourced from PubChem (CID 150573718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).