About (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide
(1-methyl-4,5-dihydroimidazol-2-yl)cyanamide (PubChem CID 15057446) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide.
Molecular Properties
| Compound Name | (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide |
| PubChem CID | 15057446 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide |
| SMILES | CN1CCN=C1NC#N |
| InChI | InChI=1S/C5H8N4/c1-9-3-2-7-5(9)8-4-6/h2-3H2,1H3,(H,7,8) |
| InChIKey | AAFKIWSCSBECGN-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide?
The IUPAC name of (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide (CID 15057446) is (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide.
What is the SMILES notation for (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide?
The canonical SMILES for (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide is CN1CCN=C1NC#N.
What is the InChIKey of (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide?
The InChIKey is AAFKIWSCSBECGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-9-3-2-7-5(9)8-4-6/h2-3H2,1H3,(H,7,8).
What are the key properties of (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide?
(1-methyl-4,5-dihydroimidazol-2-yl)cyanamide has a molecular weight of 124.15 g/mol, XLogP of -0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-4,5-dihydroimidazol-2-yl)cyanamide is sourced from PubChem (CID 15057446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).