C15H32O3 — CID 150575533
1,1,1-trimethoxy-2,2-dimethyldecane (PubChem CID 150575533) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is 1,1,1-trimethoxy-2,2-dimethyldecane.
| Compound Name | 1,1,1-trimethoxy-2,2-dimethyldecane |
|---|---|
| PubChem CID | 150575533 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | 1,1,1-trimethoxy-2,2-dimethyldecane |
| SMILES | CCCCCCCCC(C)(C)C(OC)(OC)OC |
| InChI | InChI=1S/C15H32O3/c1-7-8-9-10-11-12-13-14(2,3)15(16-4,17-5)18-6/h7-13H2,1-6H3 |
| InChIKey | IMSKPPWXLVXKAY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|