C13H14F3NO3 — CID 150577597
ethyl 3-hydroxy-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]propanoate (PubChem CID 150577597) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]propanoate.
| Compound Name | ethyl 3-hydroxy-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]propanoate |
|---|---|
| PubChem CID | 150577597 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | ethyl 3-hydroxy-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]propanoate |
| SMILES | CCOC(=O)C(CO)/N=C(\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3/c1-2-20-12(19)10(8-18)17-11(13(14,15)16)9-6-4-3-5-7-9/h3-7,10,18H,2,8H2,1H3/b17-11+ |
| InChIKey | INDKVUYNGWDTIM-GZTJUZNOSA-N |
| XLogP | 1.96 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|