C29H45NO6 — CID 15057959
[(1S,3S,7S,8S,8aR)-3-(diethylcarbamoyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 15057959) has the molecular formula C29H45NO6 and a molecular weight of 503.68 g/mol. Its IUPAC name is [(1S,3S,7S,8S,8aR)-3-(diethylcarbamoyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3S,7S,8S,8aR)-3-(diethylcarbamoyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 15057959 |
| Molecular Formula | C29H45NO6 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.32 |
| IUPAC Name | [(1S,3S,7S,8S,8aR)-3-(diethylcarbamoyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]2[C@@H](OC(=O)C(C)(C)CC)C1 |
| InChI | InChI=1S/C29H45NO6/c1-7-29(5,6)28(34)36-24-15-20(27(33)30(8-2)9-3)14-19-11-10-18(4)23(26(19)24)13-12-22-16-21(31)17-25(32)35-22/h10-11,14,18,20-24,26,31H,7-9,12-13,15-17H2,1-6H3/t18-,20+,21+,22+,23-,24-,26-/m0/s1 |
| InChIKey | BVTKMZVUUIIPKD-NHPDMGEHSA-N |
| XLogP | 4.43 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |