C25H23F5N4O3 — CID 150581984
[2-(2,4-difluorophenyl)morpholin-4-yl]-[6-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone (PubChem CID 150581984) has the molecular formula C25H23F5N4O3 and a molecular weight of 522.47 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)morpholin-4-yl]-[6-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone.
| Compound Name | [2-(2,4-difluorophenyl)morpholin-4-yl]-[6-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone |
|---|---|
| PubChem CID | 150581984 |
| Molecular Formula | C25H23F5N4O3 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | [2-(2,4-difluorophenyl)morpholin-4-yl]-[6-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone |
| SMILES | COc1ncc(C(F)(F)F)cc1C1CCc2nc(C(=O)N3CCOC(c4ccc(F)cc4F)C3)cn2C1 |
| InChI | InChI=1S/C25H23F5N4O3/c1-36-23-18(8-15(10-31-23)25(28,29)30)14-2-5-22-32-20(12-34(22)11-14)24(35)33-6-7-37-21(13-33)17-4-3-16(26)9-19(17)27/h3-4,8-10,12,14,21H,2,5-7,11,13H2,1H3 |
| InChIKey | IOAGBECBLLJYJW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |