About 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine
2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine (PubChem CID 150584047) has the molecular formula C8H7ClF2N2
and a molecular weight of 204.61 g/mol. Its IUPAC name is 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine |
| PubChem CID | 150584047 |
| Molecular Formula | C8H7ClF2N2 |
| Molecular Weight | 204.61 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine |
| SMILES | FC1(F)CC(c2ccnc(Cl)n2)C1 |
| InChI | InChI=1S/C8H7ClF2N2/c9-7-12-2-1-6(13-7)5-3-8(10,11)4-5/h1-2,5H,3-4H2 |
| InChIKey | IOLLKPSJNONTQN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine?
The IUPAC name of 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine (CID 150584047) is 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine.
What is the SMILES notation for 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine?
The canonical SMILES for 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine is FC1(F)CC(c2ccnc(Cl)n2)C1.
What is the InChIKey of 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine?
The InChIKey is IOLLKPSJNONTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF2N2/c9-7-12-2-1-6(13-7)5-3-8(10,11)4-5/h1-2,5H,3-4H2.
What are the key properties of 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine?
2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine has a molecular weight of 204.61 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(3,3-difluorocyclobutyl)pyrimidine is sourced from PubChem (CID 150584047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).