About 7-azido-3,4-dihydro-2H-isoquinolin-1-one
7-azido-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 150585195) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is 7-azido-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 7-azido-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 150585195 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 7-azido-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | [N-]=[N+]=Nc1ccc2c(c1)C(=O)NCC2 |
| InChI | InChI=1S/C9H8N4O/c10-13-12-7-2-1-6-3-4-11-9(14)8(6)5-7/h1-2,5H,3-4H2,(H,11,14) |
| InChIKey | IORMWWHOALWRGR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 7-azido-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azido-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 7-azido-3,4-dihydro-2H-isoquinolin-1-one (CID 150585195) is 7-azido-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 7-azido-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 7-azido-3,4-dihydro-2H-isoquinolin-1-one is [N-]=[N+]=Nc1ccc2c(c1)C(=O)NCC2.
What is the InChIKey of 7-azido-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is IORMWWHOALWRGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O/c10-13-12-7-2-1-6-3-4-11-9(14)8(6)5-7/h1-2,5H,3-4H2,(H,11,14).
What are the key properties of 7-azido-3,4-dihydro-2H-isoquinolin-1-one?
7-azido-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 188.19 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azido-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 150585195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).