C22H19F3N6O2 — CID 150587498
N-[2-methyl-5-[5-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 150587498) has the molecular formula C22H19F3N6O2 and a molecular weight of 456.43 g/mol. Its IUPAC name is N-[2-methyl-5-[5-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[2-methyl-5-[5-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 150587498 |
| Molecular Formula | C22H19F3N6O2 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[2-methyl-5-[5-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccc(-c2noc(C3CN(CC(F)(F)F)C3)n2)cc1NC(=O)c1cnc2ccccn12 |
| InChI | InChI=1S/C22H19F3N6O2/c1-13-5-6-14(19-28-21(33-29-19)15-10-30(11-15)12-22(23,24)25)8-16(13)27-20(32)17-9-26-18-4-2-3-7-31(17)18/h2-9,15H,10-12H2,1H3,(H,27,32) |
| InChIKey | IPDSFUIYKDWBDJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |