About 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one
6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one (PubChem CID 15058927) has the molecular formula C8H11ClN2O
and a molecular weight of 186.64 g/mol. Its IUPAC name is 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one |
| PubChem CID | 15058927 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one |
| SMILES | CCn1c(C)nc(Cl)c(C)c1=O |
| InChI | InChI=1S/C8H11ClN2O/c1-4-11-6(3)10-7(9)5(2)8(11)12/h4H2,1-3H3 |
| InChIKey | GZNBPTUXBHVYMH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one?
The IUPAC name of 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one (CID 15058927) is 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one.
What is the SMILES notation for 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one?
The canonical SMILES for 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one is CCn1c(C)nc(Cl)c(C)c1=O.
What is the InChIKey of 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one?
The InChIKey is GZNBPTUXBHVYMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2O/c1-4-11-6(3)10-7(9)5(2)8(11)12/h4H2,1-3H3.
What are the key properties of 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one?
6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one has a molecular weight of 186.64 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-ethyl-2,5-dimethylpyrimidin-4-one is sourced from PubChem (CID 15058927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).