About 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine
5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine (PubChem CID 150590039) has the molecular formula C8H6F2N4O
and a molecular weight of 212.16 g/mol. Its IUPAC name is 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine |
| PubChem CID | 150590039 |
| Molecular Formula | C8H6F2N4O |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine |
| SMILES | Nc1ccc(-c2nnc(C(F)F)o2)cn1 |
| InChI | InChI=1S/C8H6F2N4O/c9-6(10)8-14-13-7(15-8)4-1-2-5(11)12-3-4/h1-3,6H,(H2,11,12) |
| InChIKey | IPRDMAFZXOEPPJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine?
The IUPAC name of 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine (CID 150590039) is 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine.
What is the SMILES notation for 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine?
The canonical SMILES for 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine is Nc1ccc(-c2nnc(C(F)F)o2)cn1.
What is the InChIKey of 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine?
The InChIKey is IPRDMAFZXOEPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2N4O/c9-6(10)8-14-13-7(15-8)4-1-2-5(11)12-3-4/h1-3,6H,(H2,11,12).
What are the key properties of 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine?
5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine has a molecular weight of 212.16 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine is sourced from PubChem (CID 150590039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).