C22H44O5Si2 — CID 150590711
methyl 2-[(2S,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylideneoxan-2-yl]acetate (PubChem CID 150590711) has the molecular formula C22H44O5Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is methyl 2-[(2S,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylideneoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylideneoxan-2-yl]acetate |
|---|---|
| PubChem CID | 150590711 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | methyl 2-[(2S,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylideneoxan-2-yl]acetate |
| SMILES | C=C1C[C@@H](CC(=O)OC)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O5Si2/c1-16-13-17(14-19(23)24-8)26-18(15-25-28(9,10)21(2,3)4)20(16)27-29(11,12)22(5,6)7/h17-18,20H,1,13-15H2,2-12H3/t17-,18+,20-/m0/s1 |
| InChIKey | IPUQRMPQKQPRLD-NSHGMRRFSA-N |
| XLogP | 5.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|