C15H15F7N6S — CID 150590948
2-N,1-bis(3,3-difluorocyclobutyl)-6-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-2H-1,3,5-triazine-2,4-diamine (PubChem CID 150590948) has the molecular formula C15H15F7N6S and a molecular weight of 444.38 g/mol. Its IUPAC name is 2-N,1-bis(3,3-difluorocyclobutyl)-6-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-2H-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,1-bis(3,3-difluorocyclobutyl)-6-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-2H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 150590948 |
| Molecular Formula | C15H15F7N6S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-N,1-bis(3,3-difluorocyclobutyl)-6-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-2H-1,3,5-triazine-2,4-diamine |
| SMILES | NC1=NC(NC2CC(F)(F)C2)N(C2CC(F)(F)C2)C(c2csc(C(F)(F)F)n2)=N1 |
| InChI | InChI=1S/C15H15F7N6S/c16-13(17)1-6(2-13)24-12-27-11(23)26-9(28(12)7-3-14(18,19)4-7)8-5-29-10(25-8)15(20,21)22/h5-7,12,24H,1-4H2,(H2,23,27) |
| InChIKey | IPVXHSKVPADNJD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |