About 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline
4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline (PubChem CID 150592391) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline |
| PubChem CID | 150592391 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C2=CCNN2)cc1 |
| InChI | InChI=1S/C13H19N3/c1-3-16(4-2)12-7-5-11(6-8-12)13-9-10-14-15-13/h5-9,14-15H,3-4,10H2,1-2H3 |
| InChIKey | IQDKIMBWCXDYJN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline?
The IUPAC name of 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline (CID 150592391) is 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline.
What is the SMILES notation for 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline?
The canonical SMILES for 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline is CCN(CC)c1ccc(C2=CCNN2)cc1.
What is the InChIKey of 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline?
The InChIKey is IQDKIMBWCXDYJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-3-16(4-2)12-7-5-11(6-8-12)13-9-10-14-15-13/h5-9,14-15H,3-4,10H2,1-2H3.
What are the key properties of 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline?
4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline has a molecular weight of 217.32 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1H-pyrazol-5-yl)-N,N-diethylaniline is sourced from PubChem (CID 150592391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).