About 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene
1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 150593563) has the molecular formula C6H3N3O6S
and a molecular weight of 245.17 g/mol. Its IUPAC name is 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene.
Molecular Properties
| Compound Name | 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene |
| PubChem CID | 150593563 |
| Molecular Formula | C6H3N3O6S |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | O=[N+]([O-])C1=CC2([N+](=O)[O-])SC2C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C6H3N3O6S/c10-7(11)3-1-4(8(12)13)5-6(2-3,16-5)9(14)15/h1-2,5H |
| InChIKey | IQJMBEQKSVOXLB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene?
The IUPAC name of 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene (CID 150593563) is 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene?
The canonical SMILES for 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene is O=[N+]([O-])C1=CC2([N+](=O)[O-])SC2C([N+](=O)[O-])=C1.
What is the InChIKey of 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene?
The InChIKey is IQJMBEQKSVOXLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O6S/c10-7(11)3-1-4(8(12)13)5-6(2-3,16-5)9(14)15/h1-2,5H.
What are the key properties of 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene?
1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene has a molecular weight of 245.17 g/mol, XLogP of 0.41, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trinitro-7-thiabicyclo[4.1.0]hepta-2,4-diene is sourced from PubChem (CID 150593563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).