About 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine
6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine (PubChem CID 150594120) has the molecular formula C19H16F2N4
and a molecular weight of 338.36 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine |
| PubChem CID | 150594120 |
| Molecular Formula | C19H16F2N4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine |
| SMILES | CN1CN(Cc2ccncc2)c2cc(-c3ccc(F)c(F)c3)cnc21 |
| InChI | InChI=1S/C19H16F2N4/c1-24-12-25(11-13-4-6-22-7-5-13)18-9-15(10-23-19(18)24)14-2-3-16(20)17(21)8-14/h2-10H,11-12H2,1H3 |
| InChIKey | IQMPFAQNXKUSAA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine?
The IUPAC name of 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine (CID 150594120) is 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine?
The canonical SMILES for 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine is CN1CN(Cc2ccncc2)c2cc(-c3ccc(F)c(F)c3)cnc21.
What is the InChIKey of 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine?
The InChIKey is IQMPFAQNXKUSAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N4/c1-24-12-25(11-13-4-6-22-7-5-13)18-9-15(10-23-19(18)24)14-2-3-16(20)17(21)8-14/h2-10H,11-12H2,1H3.
What are the key properties of 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine?
6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine has a molecular weight of 338.36 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-difluorophenyl)-3-methyl-1-(pyridin-4-ylmethyl)-2H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 150594120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).