C16H22N2O3 — CID 150595210
tert-butyl (2S)-2-(amino-cyano-hydroxymethyl)-4-phenylbutanoate (PubChem CID 150595210) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is tert-butyl (2S)-2-(amino-cyano-hydroxymethyl)-4-phenylbutanoate.
| Compound Name | tert-butyl (2S)-2-(amino-cyano-hydroxymethyl)-4-phenylbutanoate |
|---|---|
| PubChem CID | 150595210 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | tert-butyl (2S)-2-(amino-cyano-hydroxymethyl)-4-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCc1ccccc1)C(N)(O)C#N |
| InChI | InChI=1S/C16H22N2O3/c1-15(2,3)21-14(19)13(16(18,20)11-17)10-9-12-7-5-4-6-8-12/h4-8,13,20H,9-10,18H2,1-3H3/t13-,16?/m1/s1 |
| InChIKey | IQRZGFKYLMUYFY-JBZHPUCOSA-N |
| XLogP | 1.75 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|