About 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane
3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane (PubChem CID 150600859) has the molecular formula C12H26N2O3S
and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane |
| PubChem CID | 150600859 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane |
| SMILES | CCOS(CCCC1=NCCN1)(OCC)OCC |
| InChI | InChI=1S/C12H26N2O3S/c1-4-15-18(16-5-2,17-6-3)11-7-8-12-13-9-10-14-12/h4-11H2,1-3H3,(H,13,14) |
| InChIKey | IRVQMTWWQRJUBX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane?
The IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane (CID 150600859) is 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane.
What is the SMILES notation for 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane?
The canonical SMILES for 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane is CCOS(CCCC1=NCCN1)(OCC)OCC.
What is the InChIKey of 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane?
The InChIKey is IRVQMTWWQRJUBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O3S/c1-4-15-18(16-5-2,17-6-3)11-7-8-12-13-9-10-14-12/h4-11H2,1-3H3,(H,13,14).
What are the key properties of 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane?
3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane has a molecular weight of 278.42 g/mol, XLogP of 2.43, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-triethoxy-λ4-sulfane is sourced from PubChem (CID 150600859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).